C9H13BrN2O — CID 117192180
N-[(2-bromo-1,3-oxazol-5-yl)methyl]cyclopentanamine (PubChem CID 117192180) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is N-[(2-bromo-1,3-oxazol-5-yl)methyl]cyclopentanamine.
| Compound Name | N-[(2-bromo-1,3-oxazol-5-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 117192180 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | N-[(2-bromo-1,3-oxazol-5-yl)methyl]cyclopentanamine |
| SMILES | Brc1ncc(CNC2CCCC2)o1 |
| InChI | InChI=1S/C9H13BrN2O/c10-9-12-6-8(13-9)5-11-7-3-1-2-4-7/h6-7,11H,1-5H2 |
| InChIKey | KEBVCVHLNPLNLJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |