C9H13N3O2 — CID 117192841
5-[(cyclopropylamino)methyl]-1-methylimidazole-2-carboxylic acid (PubChem CID 117192841) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-1-methylimidazole-2-carboxylic acid.
| Compound Name | 5-[(cyclopropylamino)methyl]-1-methylimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 117192841 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-1-methylimidazole-2-carboxylic acid |
| SMILES | Cn1c(CNC2CC2)cnc1C(=O)O |
| InChI | InChI=1S/C9H13N3O2/c1-12-7(4-10-6-2-3-6)5-11-8(12)9(13)14/h5-6,10H,2-4H2,1H3,(H,13,14) |
| InChIKey | OFZDOIYCYKONNZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |