About 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine
1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine (PubChem CID 117201993) has the molecular formula C12H16FNO2S
and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine.
Molecular Properties
| Compound Name | 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine |
| PubChem CID | 117201993 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine |
| SMILES | CNC(C)CC1CS(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C12H16FNO2S/c1-8(14-2)5-9-7-17(15,16)12-4-3-10(13)6-11(9)12/h3-4,6,8-9,14H,5,7H2,1-2H3 |
| InChIKey | FLZNZJYGUDZRTA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine?
The IUPAC name of 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine (CID 117201993) is 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine.
What is the SMILES notation for 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine?
The canonical SMILES for 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine is CNC(C)CC1CS(=O)(=O)c2ccc(F)cc21.
What is the InChIKey of 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine?
The InChIKey is FLZNZJYGUDZRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO2S/c1-8(14-2)5-9-7-17(15,16)12-4-3-10(13)6-11(9)12/h3-4,6,8-9,14H,5,7H2,1-2H3.
What are the key properties of 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine?
1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine has a molecular weight of 257.33 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-2-amine is sourced from PubChem (CID 117201993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).