C28H34N4O3 — CID 11720409
(2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[[2-[(4-phenylphenyl)methylamino]acetyl]amino]propanamide (PubChem CID 11720409) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is (2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[[2-[(4-phenylphenyl)methylamino]acetyl]amino]propanamide.
| Compound Name | (2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[[2-[(4-phenylphenyl)methylamino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 11720409 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[[2-[(4-phenylphenyl)methylamino]acetyl]amino]propanamide |
| SMILES | NCCOCCNC(=O)[C@H](Cc1ccccc1)NC(=O)CNCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c29-15-17-35-18-16-31-28(34)26(19-22-7-3-1-4-8-22)32-27(33)21-30-20-23-11-13-25(14-12-23)24-9-5-2-6-10-24/h1-14,26,30H,15-21,29H2,(H,31,34)(H,32,33)/t26-/m0/s1 |
| InChIKey | APUBGJLYDMGSJR-SANMLTNESA-N |
| XLogP | 2.26 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|