C22H33N3O7 — CID 170967389
2-acetamido-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3-[4-(2-oxopropanoyl)phenyl]propanamide (PubChem CID 170967389) has the molecular formula C22H33N3O7 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-acetamido-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3-[4-(2-oxopropanoyl)phenyl]propanamide.
| Compound Name | 2-acetamido-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3-[4-(2-oxopropanoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 170967389 |
| Molecular Formula | C22H33N3O7 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-acetamido-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3-[4-(2-oxopropanoyl)phenyl]propanamide |
| SMILES | CC(=O)NC(Cc1ccc(C(=O)C(C)=O)cc1)C(=O)NCCOCCOCCOCCN |
| InChI | InChI=1S/C22H33N3O7/c1-16(26)21(28)19-5-3-18(4-6-19)15-20(25-17(2)27)22(29)24-8-10-31-12-14-32-13-11-30-9-7-23/h3-6,20H,7-15,23H2,1-2H3,(H,24,29)(H,25,27) |
| InChIKey | NKEDLGRYFHLCJX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|