C16H21N3O3 — CID 44542968
(2S)-2-acetamido-3-(2-aminoethoxy)-N-[(4-ethynylphenyl)methyl]propanamide (PubChem CID 44542968) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(2-aminoethoxy)-N-[(4-ethynylphenyl)methyl]propanamide.
| Compound Name | (2S)-2-acetamido-3-(2-aminoethoxy)-N-[(4-ethynylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 44542968 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S)-2-acetamido-3-(2-aminoethoxy)-N-[(4-ethynylphenyl)methyl]propanamide |
| SMILES | C#Cc1ccc(CNC(=O)[C@H](COCCN)NC(C)=O)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-3-13-4-6-14(7-5-13)10-18-16(21)15(19-12(2)20)11-22-9-8-17/h1,4-7,15H,8-11,17H2,2H3,(H,18,21)(H,19,20)/t15-/m0/s1 |
| InChIKey | HVWMQKKQPBGZPF-HNNXBMFYSA-N |
| XLogP | -0.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|