C20H24FN3O3 — CID 44538367
(2R)-2-acetamido-N-[[4-[(3-fluoroanilino)methyl]phenyl]methyl]-3-methoxypropanamide (PubChem CID 44538367) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[[4-[(3-fluoroanilino)methyl]phenyl]methyl]-3-methoxypropanamide.
| Compound Name | (2R)-2-acetamido-N-[[4-[(3-fluoroanilino)methyl]phenyl]methyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 44538367 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (2R)-2-acetamido-N-[[4-[(3-fluoroanilino)methyl]phenyl]methyl]-3-methoxypropanamide |
| SMILES | COC[C@@H](NC(C)=O)C(=O)NCc1ccc(CNc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H24FN3O3/c1-14(25)24-19(13-27-2)20(26)23-12-16-8-6-15(7-9-16)11-22-18-5-3-4-17(21)10-18/h3-10,19,22H,11-13H2,1-2H3,(H,23,26)(H,24,25)/t19-/m1/s1 |
| InChIKey | PKVAVKORCDFOIX-LJQANCHMSA-N |
| XLogP | 2.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |