C22H27FN2O4 — CID 75044819
2-acetamido-N-[[4-[3-(3-fluorophenoxy)propyl]phenyl]methyl]-3-methoxypropanamide (PubChem CID 75044819) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-acetamido-N-[[4-[3-(3-fluorophenoxy)propyl]phenyl]methyl]-3-methoxypropanamide.
| Compound Name | 2-acetamido-N-[[4-[3-(3-fluorophenoxy)propyl]phenyl]methyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 75044819 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-acetamido-N-[[4-[3-(3-fluorophenoxy)propyl]phenyl]methyl]-3-methoxypropanamide |
| SMILES | COCC(NC(C)=O)C(=O)NCc1ccc(CCCOc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H27FN2O4/c1-16(26)25-21(15-28-2)22(27)24-14-18-10-8-17(9-11-18)5-4-12-29-20-7-3-6-19(23)13-20/h3,6-11,13,21H,4-5,12,14-15H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | VMAWIXAXZVJQOK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|