C22H24FNO3 — CID 123667708
N-[(2R)-5-[4-[2-(3-fluorophenyl)ethenyl]phenyl]-1-methoxy-3-oxopentan-2-yl]acetamide (PubChem CID 123667708) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[(2R)-5-[4-[2-(3-fluorophenyl)ethenyl]phenyl]-1-methoxy-3-oxopentan-2-yl]acetamide.
| Compound Name | N-[(2R)-5-[4-[2-(3-fluorophenyl)ethenyl]phenyl]-1-methoxy-3-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 123667708 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[(2R)-5-[4-[2-(3-fluorophenyl)ethenyl]phenyl]-1-methoxy-3-oxopentan-2-yl]acetamide |
| SMILES | COC[C@@H](NC(C)=O)C(=O)CCc1ccc(C=Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H24FNO3/c1-16(25)24-21(15-27-2)22(26)13-12-18-8-6-17(7-9-18)10-11-19-4-3-5-20(23)14-19/h3-11,14,21H,12-13,15H2,1-2H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | ZRZDZVBZXXYBKA-OAQYLSRUSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|