C18H26N2O3Si — CID 45486472
(2S)-2-acetamido-3-methoxy-N-[[4-(2-trimethylsilylethynyl)phenyl]methyl]propanamide (PubChem CID 45486472) has the molecular formula C18H26N2O3Si and a molecular weight of 346.50 g/mol. Its IUPAC name is (2S)-2-acetamido-3-methoxy-N-[[4-(2-trimethylsilylethynyl)phenyl]methyl]propanamide.
| Compound Name | (2S)-2-acetamido-3-methoxy-N-[[4-(2-trimethylsilylethynyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 45486472 |
| Molecular Formula | C18H26N2O3Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S)-2-acetamido-3-methoxy-N-[[4-(2-trimethylsilylethynyl)phenyl]methyl]propanamide |
| SMILES | COC[C@H](NC(C)=O)C(=O)NCc1ccc(C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O3Si/c1-14(21)20-17(13-23-2)18(22)19-12-16-8-6-15(7-9-16)10-11-24(3,4)5/h6-9,17H,12-13H2,1-5H3,(H,19,22)(H,20,21)/t17-/m0/s1 |
| InChIKey | GNKVIXYFUVFNLO-KRWDZBQOSA-N |
| XLogP | 1.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|