C15H21NO2Si — CID 59451860
(2R)-2-[[4-(2-trimethylsilylethynyl)phenyl]methylamino]propanoic acid (PubChem CID 59451860) has the molecular formula C15H21NO2Si and a molecular weight of 275.42 g/mol. Its IUPAC name is (2R)-2-[[4-(2-trimethylsilylethynyl)phenyl]methylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-(2-trimethylsilylethynyl)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 59451860 |
| Molecular Formula | C15H21NO2Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2R)-2-[[4-(2-trimethylsilylethynyl)phenyl]methylamino]propanoic acid |
| SMILES | C[C@@H](NCc1ccc(C#C[Si](C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C15H21NO2Si/c1-12(15(17)18)16-11-14-7-5-13(6-8-14)9-10-19(2,3)4/h5-8,12,16H,11H2,1-4H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | BMFZMLSXKPCXCU-GFCCVEGCSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|