C26H41ClN4O3 — CID 11663236
(2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]propanoylamino]propanamide;hydrochloride (PubChem CID 11663236) has the molecular formula C26H41ClN4O3 and a molecular weight of 493.09 g/mol. Its IUPAC name is (2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]propanoylamino]propanamide;hydrochloride.
| Compound Name | (2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]propanoylamino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 11663236 |
| Molecular Formula | C26H41ClN4O3 |
| Molecular Weight | 493.09 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (2S)-N-[2-(2-aminoethoxy)ethyl]-3-phenyl-2-[3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]propanoylamino]propanamide;hydrochloride |
| SMILES | C=C(C)[C@@H]1CC=C(CNCCC(=O)N[C@@H](Cc2ccccc2)C(=O)NCCOCCN)CC1.Cl |
| InChI | InChI=1S/C26H40N4O3.ClH/c1-20(2)23-10-8-22(9-11-23)19-28-14-12-25(31)30-24(18-21-6-4-3-5-7-21)26(32)29-15-17-33-16-13-27;/h3-8,23-24,28H,1,9-19,27H2,2H3,(H,29,32)(H,30,31);1H/t23-,24+;/m1./s1 |
| InChIKey | IETITWGBRHMURI-ITNPDYSASA-N |
| XLogP | 2.51 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|