C26H28Cl2F3NO2 — CID 11720456
2-[1-[1-(2,4-dichlorophenyl)-4-methylpent-4-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid (PubChem CID 11720456) has the molecular formula C26H28Cl2F3NO2 and a molecular weight of 514.42 g/mol. Its IUPAC name is 2-[1-[1-(2,4-dichlorophenyl)-4-methylpent-4-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[1-(2,4-dichlorophenyl)-4-methylpent-4-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 11720456 |
| Molecular Formula | C26H28Cl2F3NO2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-[1-[1-(2,4-dichlorophenyl)-4-methylpent-4-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
| SMILES | C=C(C)CCC(c1ccc(Cl)cc1Cl)N1CCC(CC(=O)O)CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H28Cl2F3NO2/c1-16(2)3-10-23(21-9-8-20(27)15-22(21)28)32-12-11-17(14-25(33)34)13-24(32)18-4-6-19(7-5-18)26(29,30)31/h4-9,15,17,23-24H,1,3,10-14H2,2H3,(H,33,34) |
| InChIKey | GDOYQPWFFCWPLH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|