C6H10FN — CID 117205462
3-(fluoromethyl)-1-methyl-2,5-dihydropyrrole (PubChem CID 117205462) has the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. Its IUPAC name is 3-(fluoromethyl)-1-methyl-2,5-dihydropyrrole.
| Compound Name | 3-(fluoromethyl)-1-methyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 117205462 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | 3-(fluoromethyl)-1-methyl-2,5-dihydropyrrole |
| SMILES | CN1CC=C(CF)C1 |
| InChI | InChI=1S/C6H10FN/c1-8-3-2-6(4-7)5-8/h2H,3-5H2,1H3 |
| InChIKey | XDVHDRUTFYQYFA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|