C13H15ClN2O3S — CID 117206543
7-chloro-3-[(1,1-dioxothian-3-yl)methyl]-1H-benzimidazol-2-one (PubChem CID 117206543) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 7-chloro-3-[(1,1-dioxothian-3-yl)methyl]-1H-benzimidazol-2-one.
| Compound Name | 7-chloro-3-[(1,1-dioxothian-3-yl)methyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117206543 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 7-chloro-3-[(1,1-dioxothian-3-yl)methyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2c(Cl)cccc2n1CC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15ClN2O3S/c14-10-4-1-5-11-12(10)15-13(17)16(11)7-9-3-2-6-20(18,19)8-9/h1,4-5,9H,2-3,6-8H2,(H,15,17) |
| InChIKey | GVDHLPDSCNZCFB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |