C14H18N2O3S — CID 117206250
3-[(1,1-dioxothian-4-yl)methyl]-7-methyl-1H-benzimidazol-2-one (PubChem CID 117206250) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)methyl]-7-methyl-1H-benzimidazol-2-one.
| Compound Name | 3-[(1,1-dioxothian-4-yl)methyl]-7-methyl-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117206250 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)methyl]-7-methyl-1H-benzimidazol-2-one |
| SMILES | Cc1cccc2c1[nH]c(=O)n2CC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18N2O3S/c1-10-3-2-4-12-13(10)15-14(17)16(12)9-11-5-7-20(18,19)8-6-11/h2-4,11H,5-9H2,1H3,(H,15,17) |
| InChIKey | OVJMCMKWXQPJMR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |