C14H18N2O4S — CID 117207139
3-[(1,1-dioxothian-4-yl)methyl]-6-methoxy-1H-benzimidazol-2-one (PubChem CID 117207139) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)methyl]-6-methoxy-1H-benzimidazol-2-one.
| Compound Name | 3-[(1,1-dioxothian-4-yl)methyl]-6-methoxy-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117207139 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)methyl]-6-methoxy-1H-benzimidazol-2-one |
| SMILES | COc1ccc2c(c1)[nH]c(=O)n2CC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18N2O4S/c1-20-11-2-3-13-12(8-11)15-14(17)16(13)9-10-4-6-21(18,19)7-5-10/h2-3,8,10H,4-7,9H2,1H3,(H,15,17) |
| InChIKey | AWHBPIDFKYGVEW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |