C15H14N2O3 — CID 117207490
3-[(3-hydroxyphenyl)methyl]-6-methoxy-1H-benzimidazol-2-one (PubChem CID 117207490) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-[(3-hydroxyphenyl)methyl]-6-methoxy-1H-benzimidazol-2-one.
| Compound Name | 3-[(3-hydroxyphenyl)methyl]-6-methoxy-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117207490 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[(3-hydroxyphenyl)methyl]-6-methoxy-1H-benzimidazol-2-one |
| SMILES | COc1ccc2c(c1)[nH]c(=O)n2Cc1cccc(O)c1 |
| InChI | InChI=1S/C15H14N2O3/c1-20-12-5-6-14-13(8-12)16-15(19)17(14)9-10-3-2-4-11(18)7-10/h2-8,18H,9H2,1H3,(H,16,19) |
| InChIKey | JDBPAQQOECSEKS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |