C10H10N2O3 — CID 83833187
2-(5-methoxy-2-oxo-3H-benzimidazol-1-yl)acetaldehyde (PubChem CID 83833187) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-(5-methoxy-2-oxo-3H-benzimidazol-1-yl)acetaldehyde.
| Compound Name | 2-(5-methoxy-2-oxo-3H-benzimidazol-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 83833187 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-(5-methoxy-2-oxo-3H-benzimidazol-1-yl)acetaldehyde |
| SMILES | COc1ccc2c(c1)[nH]c(=O)n2CC=O |
| InChI | InChI=1S/C10H10N2O3/c1-15-7-2-3-9-8(6-7)11-10(14)12(9)4-5-13/h2-3,5-6H,4H2,1H3,(H,11,14) |
| InChIKey | QHDWFSSIBLRXNH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|