C20H21ClN4O7S2 — CID 11720680
10-chloro-N-(diaminomethylidene)-1-methyl-8-morpholin-4-ylsulfonyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11720680) has the molecular formula C20H21ClN4O7S2 and a molecular weight of 529.00 g/mol. Its IUPAC name is 10-chloro-N-(diaminomethylidene)-1-methyl-8-morpholin-4-ylsulfonyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | 10-chloro-N-(diaminomethylidene)-1-methyl-8-morpholin-4-ylsulfonyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11720680 |
| Molecular Formula | C20H21ClN4O7S2 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 10-chloro-N-(diaminomethylidene)-1-methyl-8-morpholin-4-ylsulfonyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N=C(N)N)cc2c1Oc1c(Cl)cc(S(=O)(=O)N3CCOCC3)cc1CS2(=O)=O |
| InChI | InChI=1S/C20H21ClN4O7S2/c1-11-6-12(19(26)24-20(22)23)8-16-17(11)32-18-13(10-33(16,27)28)7-14(9-15(18)21)34(29,30)25-2-4-31-5-3-25/h6-9H,2-5,10H2,1H3,(H4,22,23,24,26) |
| InChIKey | GKEDDDPAIKTFTF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|