C11H13BrN4 — CID 117209938
N'-[5-(4-bromophenyl)-1H-pyrazol-4-yl]ethane-1,2-diamine (PubChem CID 117209938) has the molecular formula C11H13BrN4 and a molecular weight of 281.16 g/mol. Its IUPAC name is N'-[5-(4-bromophenyl)-1H-pyrazol-4-yl]ethane-1,2-diamine.
| Compound Name | N'-[5-(4-bromophenyl)-1H-pyrazol-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 117209938 |
| Molecular Formula | C11H13BrN4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N'-[5-(4-bromophenyl)-1H-pyrazol-4-yl]ethane-1,2-diamine |
| SMILES | NCCNc1cn[nH]c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrN4/c12-9-3-1-8(2-4-9)11-10(7-15-16-11)14-6-5-13/h1-4,7,14H,5-6,13H2,(H,15,16) |
| InChIKey | HHLMPSTYNLIMOF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |