C12H22N4 — CID 117210022
1-[5-(2,2-dimethylpropyl)-1H-pyrazol-4-yl]piperazine (PubChem CID 117210022) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-[5-(2,2-dimethylpropyl)-1H-pyrazol-4-yl]piperazine.
| Compound Name | 1-[5-(2,2-dimethylpropyl)-1H-pyrazol-4-yl]piperazine |
|---|---|
| PubChem CID | 117210022 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-[5-(2,2-dimethylpropyl)-1H-pyrazol-4-yl]piperazine |
| SMILES | CC(C)(C)Cc1[nH]ncc1N1CCNCC1 |
| InChI | InChI=1S/C12H22N4/c1-12(2,3)8-10-11(9-14-15-10)16-6-4-13-5-7-16/h9,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | FDZLUTXACKPJBR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |