C14H16F3N3O — CID 117210109
N'-[5-[[2-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-4-yl]propane-1,3-diamine (PubChem CID 117210109) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is N'-[5-[[2-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-4-yl]propane-1,3-diamine.
| Compound Name | N'-[5-[[2-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117210109 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N'-[5-[[2-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-4-yl]propane-1,3-diamine |
| SMILES | NCCCNc1cnoc1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)11-5-2-1-4-10(11)8-13-12(9-20-21-13)19-7-3-6-18/h1-2,4-5,9,19H,3,6-8,18H2 |
| InChIKey | CDAXGJHEXUBQDT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|