C12H13ClN4 — CID 117211188
N'-[4-(2-chlorophenyl)pyrimidin-5-yl]ethane-1,2-diamine (PubChem CID 117211188) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is N'-[4-(2-chlorophenyl)pyrimidin-5-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(2-chlorophenyl)pyrimidin-5-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 117211188 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N'-[4-(2-chlorophenyl)pyrimidin-5-yl]ethane-1,2-diamine |
| SMILES | NCCNc1cncnc1-c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN4/c13-10-4-2-1-3-9(10)12-11(16-6-5-14)7-15-8-17-12/h1-4,7-8,16H,5-6,14H2 |
| InChIKey | YVGUSNPPCBVDKT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |