C16H19ClN4 — CID 117211859
N'-[4-(2-chlorophenyl)-2-cyclopropylpyrimidin-5-yl]propane-1,3-diamine (PubChem CID 117211859) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is N'-[4-(2-chlorophenyl)-2-cyclopropylpyrimidin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[4-(2-chlorophenyl)-2-cyclopropylpyrimidin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117211859 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N'-[4-(2-chlorophenyl)-2-cyclopropylpyrimidin-5-yl]propane-1,3-diamine |
| SMILES | NCCCNc1cnc(C2CC2)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN4/c17-13-5-2-1-4-12(13)15-14(19-9-3-8-18)10-20-16(21-15)11-6-7-11/h1-2,4-5,10-11,19H,3,6-9,18H2 |
| InChIKey | SJCMGENWRFYMMA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|