C12H20N4 — CID 117212128
N'-(2-cyclopropyl-4-ethylpyrimidin-5-yl)propane-1,3-diamine (PubChem CID 117212128) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N'-(2-cyclopropyl-4-ethylpyrimidin-5-yl)propane-1,3-diamine.
| Compound Name | N'-(2-cyclopropyl-4-ethylpyrimidin-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 117212128 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N'-(2-cyclopropyl-4-ethylpyrimidin-5-yl)propane-1,3-diamine |
| SMILES | CCc1nc(C2CC2)ncc1NCCCN |
| InChI | InChI=1S/C12H20N4/c1-2-10-11(14-7-3-6-13)8-15-12(16-10)9-4-5-9/h8-9,14H,2-7,13H2,1H3 |
| InChIKey | RRKSNAMROUSOMV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|