C12H22N4 — CID 117212191
N'-(2-ethyl-4-propan-2-ylpyrimidin-5-yl)propane-1,3-diamine (PubChem CID 117212191) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N'-(2-ethyl-4-propan-2-ylpyrimidin-5-yl)propane-1,3-diamine.
| Compound Name | N'-(2-ethyl-4-propan-2-ylpyrimidin-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 117212191 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N'-(2-ethyl-4-propan-2-ylpyrimidin-5-yl)propane-1,3-diamine |
| SMILES | CCc1ncc(NCCCN)c(C(C)C)n1 |
| InChI | InChI=1S/C12H22N4/c1-4-11-15-8-10(14-7-5-6-13)12(16-11)9(2)3/h8-9,14H,4-7,13H2,1-3H3 |
| InChIKey | MIQOLKPJACFWKT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|