C10H8N2O4S — CID 117218179
phenyl 3-amino-1,1-dioxo-1,2-thiazole-5-carboxylate (PubChem CID 117218179) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is phenyl 3-amino-1,1-dioxo-1,2-thiazole-5-carboxylate.
| Compound Name | phenyl 3-amino-1,1-dioxo-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 117218179 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | phenyl 3-amino-1,1-dioxo-1,2-thiazole-5-carboxylate |
| SMILES | NC1=NS(=O)(=O)C(C(=O)Oc2ccccc2)=C1 |
| InChI | InChI=1S/C10H8N2O4S/c11-9-6-8(17(14,15)12-9)10(13)16-7-4-2-1-3-5-7/h1-6H,(H2,11,12) |
| InChIKey | ZBYUQLUSXLWDMP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|