C10H8ClNO2S — CID 117222734
5-(3-chlorophenyl)-1,1-dioxothiophen-2-amine (PubChem CID 117222734) has the molecular formula C10H8ClNO2S and a molecular weight of 241.70 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-1,1-dioxothiophen-2-amine.
| Compound Name | 5-(3-chlorophenyl)-1,1-dioxothiophen-2-amine |
|---|---|
| PubChem CID | 117222734 |
| Molecular Formula | C10H8ClNO2S |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 5-(3-chlorophenyl)-1,1-dioxothiophen-2-amine |
| SMILES | NC1=CC=C(c2cccc(Cl)c2)S1(=O)=O |
| InChI | InChI=1S/C10H8ClNO2S/c11-8-3-1-2-7(6-8)9-4-5-10(12)15(9,13)14/h1-6H,12H2 |
| InChIKey | GGRDUCJFTHRTFM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |