C9H5Cl2NO2S — CID 117259012
5-chloro-2-(3-chlorophenyl)-1,3-thiazole 1,1-dioxide (PubChem CID 117259012) has the molecular formula C9H5Cl2NO2S and a molecular weight of 262.12 g/mol. Its IUPAC name is 5-chloro-2-(3-chlorophenyl)-1,3-thiazole 1,1-dioxide.
| Compound Name | 5-chloro-2-(3-chlorophenyl)-1,3-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 117259012 |
| Molecular Formula | C9H5Cl2NO2S |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 260.94 |
| IUPAC Name | 5-chloro-2-(3-chlorophenyl)-1,3-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)C(Cl)=CN=C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H5Cl2NO2S/c10-7-3-1-2-6(4-7)9-12-5-8(11)15(9,13)14/h1-5H |
| InChIKey | MHGBHFBCXXUTGO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |