C12H12N2O3S — CID 117224670
5-[(2-methoxyphenyl)methyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid (PubChem CID 117224670) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-[(2-methoxyphenyl)methyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid.
| Compound Name | 5-[(2-methoxyphenyl)methyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117224670 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-[(2-methoxyphenyl)methyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
| SMILES | COc1ccccc1Cc1[nH]c(=S)[nH]c1C(=O)O |
| InChI | InChI=1S/C12H12N2O3S/c1-17-9-5-3-2-4-7(9)6-8-10(11(15)16)14-12(18)13-8/h2-5H,6H2,1H3,(H,15,16)(H2,13,14,18) |
| InChIKey | BXWHBLSIFOCKCG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|