C14H16N2O3S — CID 117225129
methyl 4-[(2-methoxyphenyl)methyl]-3-methyl-2-sulfanylidene-1H-imidazole-5-carboxylate (PubChem CID 117225129) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is methyl 4-[(2-methoxyphenyl)methyl]-3-methyl-2-sulfanylidene-1H-imidazole-5-carboxylate.
| Compound Name | methyl 4-[(2-methoxyphenyl)methyl]-3-methyl-2-sulfanylidene-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 117225129 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 4-[(2-methoxyphenyl)methyl]-3-methyl-2-sulfanylidene-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]c(=S)n(C)c1Cc1ccccc1OC |
| InChI | InChI=1S/C14H16N2O3S/c1-16-10(12(13(17)19-3)15-14(16)20)8-9-6-4-5-7-11(9)18-2/h4-7H,8H2,1-3H3,(H,15,20) |
| InChIKey | JGJNWPUHYBOPND-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|