C9H14N2O2S — CID 117225166
methyl 3-methyl-4-propyl-2-sulfanylidene-1H-imidazole-5-carboxylate (PubChem CID 117225166) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is methyl 3-methyl-4-propyl-2-sulfanylidene-1H-imidazole-5-carboxylate.
| Compound Name | methyl 3-methyl-4-propyl-2-sulfanylidene-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 117225166 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | methyl 3-methyl-4-propyl-2-sulfanylidene-1H-imidazole-5-carboxylate |
| SMILES | CCCc1c(C(=O)OC)[nH]c(=S)n1C |
| InChI | InChI=1S/C9H14N2O2S/c1-4-5-6-7(8(12)13-3)10-9(14)11(6)2/h4-5H2,1-3H3,(H,10,14) |
| InChIKey | MBEQGCZVLUDNNE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|