C13H22N4O3 — CID 117225270
methyl 3-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-2-oxo-1H-imidazole-5-carboxylate (PubChem CID 117225270) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 3-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-2-oxo-1H-imidazole-5-carboxylate.
| Compound Name | methyl 3-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-2-oxo-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 117225270 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl 3-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-2-oxo-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]c(=O)n(C)c1CCN1CCN(C)CC1 |
| InChI | InChI=1S/C13H22N4O3/c1-15-6-8-17(9-7-15)5-4-10-11(12(18)20-3)14-13(19)16(10)2/h4-9H2,1-3H3,(H,14,19) |
| InChIKey | TWKGPECKDGJJHJ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |