C7H10N2O2S — CID 117225161
methyl 5-ethyl-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate (PubChem CID 117225161) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is methyl 5-ethyl-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate.
| Compound Name | methyl 5-ethyl-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate |
|---|---|
| PubChem CID | 117225161 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | methyl 5-ethyl-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate |
| SMILES | CCc1[nH]c(=S)[nH]c1C(=O)OC |
| InChI | InChI=1S/C7H10N2O2S/c1-3-4-5(6(10)11-2)9-7(12)8-4/h3H2,1-2H3,(H2,8,9,12) |
| InChIKey | JEDXOBPIAIWUEG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|