C9H14N2O4 — CID 117225302
methyl 5-(3-methoxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxylate (PubChem CID 117225302) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is methyl 5-(3-methoxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxylate.
| Compound Name | methyl 5-(3-methoxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxylate |
|---|---|
| PubChem CID | 117225302 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | methyl 5-(3-methoxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxylate |
| SMILES | COCCCc1[nH]c(=O)[nH]c1C(=O)OC |
| InChI | InChI=1S/C9H14N2O4/c1-14-5-3-4-6-7(8(12)15-2)11-9(13)10-6/h3-5H2,1-2H3,(H2,10,11,13) |
| InChIKey | ULBRHKAATRWUMH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|