C15H23NO — CID 117226801
2,5,5-trimethyl-2-[(3-methylphenyl)methyl]-1,3-oxazinane (PubChem CID 117226801) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-[(3-methylphenyl)methyl]-1,3-oxazinane.
| Compound Name | 2,5,5-trimethyl-2-[(3-methylphenyl)methyl]-1,3-oxazinane |
|---|---|
| PubChem CID | 117226801 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2,5,5-trimethyl-2-[(3-methylphenyl)methyl]-1,3-oxazinane |
| SMILES | Cc1cccc(CC2(C)NCC(C)(C)CO2)c1 |
| InChI | InChI=1S/C15H23NO/c1-12-6-5-7-13(8-12)9-15(4)16-10-14(2,3)11-17-15/h5-8,16H,9-11H2,1-4H3 |
| InChIKey | FZEBVKXFMSPOET-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |