C16H24O2 — CID 79928455
2,2,5,5-tetramethyl-3-[(3-methylphenyl)methyl]oxolan-3-ol (PubChem CID 79928455) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3-[(3-methylphenyl)methyl]oxolan-3-ol.
| Compound Name | 2,2,5,5-tetramethyl-3-[(3-methylphenyl)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 79928455 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2,2,5,5-tetramethyl-3-[(3-methylphenyl)methyl]oxolan-3-ol |
| SMILES | Cc1cccc(CC2(O)CC(C)(C)OC2(C)C)c1 |
| InChI | InChI=1S/C16H24O2/c1-12-7-6-8-13(9-12)10-16(17)11-14(2,3)18-15(16,4)5/h6-9,17H,10-11H2,1-5H3 |
| InChIKey | NXOKUTFQNHEPQP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |