C18H15ClO3 — CID 11723188
(4-chlorophenyl)-(1,4-dihydroxy-6-methyl-5,8-dihydronaphthalen-2-yl)methanone (PubChem CID 11723188) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,4-dihydroxy-6-methyl-5,8-dihydronaphthalen-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(1,4-dihydroxy-6-methyl-5,8-dihydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 11723188 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (4-chlorophenyl)-(1,4-dihydroxy-6-methyl-5,8-dihydronaphthalen-2-yl)methanone |
| SMILES | CC1=CCc2c(O)c(C(=O)c3ccc(Cl)cc3)cc(O)c2C1 |
| InChI | InChI=1S/C18H15ClO3/c1-10-2-7-13-14(8-10)16(20)9-15(18(13)22)17(21)11-3-5-12(19)6-4-11/h2-6,9,20,22H,7-8H2,1H3 |
| InChIKey | LGXUGGVQAUICQQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|