C13H8F3NO3S — CID 11723198
ethyl 6,7,8-trifluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate (PubChem CID 11723198) has the molecular formula C13H8F3NO3S and a molecular weight of 315.27 g/mol. Its IUPAC name is ethyl 6,7,8-trifluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate.
| Compound Name | ethyl 6,7,8-trifluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 11723198 |
| Molecular Formula | C13H8F3NO3S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | ethyl 6,7,8-trifluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c2n(c3c(F)c(F)c(F)cc3c1=O)CS2 |
| InChI | InChI=1S/C13H8F3NO3S/c1-2-20-13(19)7-11(18)5-3-6(14)8(15)9(16)10(5)17-4-21-12(7)17/h3H,2,4H2,1H3 |
| InChIKey | HTNOBSIEZOOISX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|