1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid

C9H8N2O4 — CID 117232486

IUPAC1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid
SMILESCOc1cnn(-c2ccco2)c1C(=O)O
InChIInChI=1S/C9H8N2O4/c1-14-6-5-10-11(8(6)9(12)13)7-3-2-4-15-7/h2-5H,1H3,(H,12,13)
InChIKeyHOVNQUJMIQKOFA-UHFFFAOYSA-N
MW208.17 g/mol
LogP1.17
Rot. Bonds3

About 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid

1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid (PubChem CID 117232486) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid.

Molecular Properties

Compound Name1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid
PubChem CID117232486
Molecular FormulaC9H8N2O4
Molecular Weight208.17 g/mol
Exact Mass208.05
IUPAC Name1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid
SMILESCOc1cnn(-c2ccco2)c1C(=O)O
InChIInChI=1S/C9H8N2O4/c1-14-6-5-10-11(8(6)9(12)13)7-3-2-4-15-7/h2-5H,1H3,(H,12,13)
InChIKeyHOVNQUJMIQKOFA-UHFFFAOYSA-N
XLogP1.17
TPSA77.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.17
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-methoxy-1-(5-methylfuran-2-yl)pyrazole-5-carboxylic acid
CID 117232488
4-methoxy-1-(4-methoxyphenyl)pyrazole-5-carboxylic acid
CID 117233112
4-methoxy-1-(3-methoxyphenyl)pyrazole-5-carboxylic acid
CID 117232958
1-(4-chlorophenyl)-4-methoxypyrazole-5-carboxylic acid
CID 117233107
4-methoxy-1-methylpyrazole-5-carboxylic acid
CID 46398720
1-(5-chlorothiophen-2-yl)-4-methoxypyrazole-5-carboxylic acid
CID 117232498
1-fluorosulfanyl-4-methoxypyrazole-5-carboxylic acid
CID 170756114
1-cyclobutyl-4-methoxypyrazole-5-carboxylic acid
CID 117233148
N-[4-[1-(3,4-dimethoxyphenyl)ethenoxy]-2H-azepin-7-yl]-4-ethoxy-1-(furan-2-yl)pyrazole-5-carboxamide;N-methylmethanimine
CID 145169581
(2R)-2-amino-1-(4-methoxy-1-methylpyrazol-5-yl)-2-phenylethanone
CID 104940695
4-methoxy-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-5-carboxylic acid
CID 117232726
methyl 4-methoxy-1-methylpyrazole-5-carboxylate
CID 106942430

Frequently Asked Questions

What is the IUPAC name of 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid?
The IUPAC name of 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid (CID 117232486) is 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid.
What is the SMILES notation for 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid?
The canonical SMILES for 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid is COc1cnn(-c2ccco2)c1C(=O)O.
What is the InChIKey of 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid?
The InChIKey is HOVNQUJMIQKOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c1-14-6-5-10-11(8(6)9(12)13)7-3-2-4-15-7/h2-5H,1H3,(H,12,13).
What are the key properties of 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid?
1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid has a molecular weight of 208.17 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)-4-methoxypyrazole-5-carboxylic acid is sourced from PubChem (CID 117232486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).