C28H31N5O6 — CID 145169581
N-[4-[1-(3,4-dimethoxyphenyl)ethenoxy]-2H-azepin-7-yl]-4-ethoxy-1-(furan-2-yl)pyrazole-5-carboxamide;N-methylmethanimine (PubChem CID 145169581) has the molecular formula C28H31N5O6 and a molecular weight of 533.59 g/mol. Its IUPAC name is N-[4-[1-(3,4-dimethoxyphenyl)ethenoxy]-2H-azepin-7-yl]-4-ethoxy-1-(furan-2-yl)pyrazole-5-carboxamide;N-methylmethanimine.
| Compound Name | N-[4-[1-(3,4-dimethoxyphenyl)ethenoxy]-2H-azepin-7-yl]-4-ethoxy-1-(furan-2-yl)pyrazole-5-carboxamide;N-methylmethanimine |
|---|---|
| PubChem CID | 145169581 |
| Molecular Formula | C28H31N5O6 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | N-[4-[1-(3,4-dimethoxyphenyl)ethenoxy]-2H-azepin-7-yl]-4-ethoxy-1-(furan-2-yl)pyrazole-5-carboxamide;N-methylmethanimine |
| SMILES | C=C(OC1=CCN=C(NC(=O)c2c(OCC)cnn2-c2ccco2)C=C1)c1ccc(OC)c(OC)c1.C=NC |
| InChI | InChI=1S/C26H26N4O6.C2H5N/c1-5-34-22-16-28-30(24-7-6-14-35-24)25(22)26(31)29-23-11-9-19(12-13-27-23)36-17(2)18-8-10-20(32-3)21(15-18)33-4;1-3-2/h6-12,14-16H,2,5,13H2,1,3-4H3,(H,27,29,31);1H2,2H3 |
| InChIKey | ZOAGWRGDFJOIJH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|