C8H11NO4S — CID 117233297
4-(1,2-oxazol-4-yloxy)thiane 1,1-dioxide (PubChem CID 117233297) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is 4-(1,2-oxazol-4-yloxy)thiane 1,1-dioxide.
| Compound Name | 4-(1,2-oxazol-4-yloxy)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117233297 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 4-(1,2-oxazol-4-yloxy)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Oc2cnoc2)CC1 |
| InChI | InChI=1S/C8H11NO4S/c10-14(11)3-1-7(2-4-14)13-8-5-9-12-6-8/h5-7H,1-4H2 |
| InChIKey | VAEWZDVRWRMPNH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |