C14H20O5S — CID 117239292
3-[2-(1,1-dioxothian-4-yl)-3-hydroxypropoxy]phenol (PubChem CID 117239292) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[2-(1,1-dioxothian-4-yl)-3-hydroxypropoxy]phenol.
| Compound Name | 3-[2-(1,1-dioxothian-4-yl)-3-hydroxypropoxy]phenol |
|---|---|
| PubChem CID | 117239292 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-[2-(1,1-dioxothian-4-yl)-3-hydroxypropoxy]phenol |
| SMILES | O=S1(=O)CCC(C(CO)COc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C14H20O5S/c15-9-12(11-4-6-20(17,18)7-5-11)10-19-14-3-1-2-13(16)8-14/h1-3,8,11-12,15-16H,4-7,9-10H2 |
| InChIKey | FJLWXDODNFAHOW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |