C14H21NO4S — CID 117239371
4-[3-amino-2-(1,1-dioxothian-4-yl)propoxy]phenol (PubChem CID 117239371) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[3-amino-2-(1,1-dioxothian-4-yl)propoxy]phenol.
| Compound Name | 4-[3-amino-2-(1,1-dioxothian-4-yl)propoxy]phenol |
|---|---|
| PubChem CID | 117239371 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[3-amino-2-(1,1-dioxothian-4-yl)propoxy]phenol |
| SMILES | NCC(COc1ccc(O)cc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H21NO4S/c15-9-12(11-5-7-20(17,18)8-6-11)10-19-14-3-1-13(16)2-4-14/h1-4,11-12,16H,5-10,15H2 |
| InChIKey | JBSNCGSEMZTSSO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |