C13H19NO4S — CID 117237935
4-[3-amino-2-(1,1-dioxothiolan-3-yl)propoxy]phenol (PubChem CID 117237935) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-[3-amino-2-(1,1-dioxothiolan-3-yl)propoxy]phenol.
| Compound Name | 4-[3-amino-2-(1,1-dioxothiolan-3-yl)propoxy]phenol |
|---|---|
| PubChem CID | 117237935 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-[3-amino-2-(1,1-dioxothiolan-3-yl)propoxy]phenol |
| SMILES | NCC(COc1ccc(O)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H19NO4S/c14-7-11(10-5-6-19(16,17)9-10)8-18-13-3-1-12(15)2-4-13/h1-4,10-11,15H,5-9,14H2 |
| InChIKey | QFGLPQWNTPQDTG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |