C13H18ClNO3S — CID 117237746
3-(2-chlorophenoxy)-2-(1,1-dioxothiolan-3-yl)propan-1-amine (PubChem CID 117237746) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-2-(1,1-dioxothiolan-3-yl)propan-1-amine.
| Compound Name | 3-(2-chlorophenoxy)-2-(1,1-dioxothiolan-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 117237746 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(2-chlorophenoxy)-2-(1,1-dioxothiolan-3-yl)propan-1-amine |
| SMILES | NCC(COc1ccccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18ClNO3S/c14-12-3-1-2-4-13(12)18-8-11(7-15)10-5-6-19(16,17)9-10/h1-4,10-11H,5-9,15H2 |
| InChIKey | PXNVBRQDJRWMEQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |