C14H18O6S — CID 117239796
2-(1,1-dioxothian-4-yl)-3-(4-hydroxyphenoxy)propanoic acid (PubChem CID 117239796) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-3-(4-hydroxyphenoxy)propanoic acid.
| Compound Name | 2-(1,1-dioxothian-4-yl)-3-(4-hydroxyphenoxy)propanoic acid |
|---|---|
| PubChem CID | 117239796 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-3-(4-hydroxyphenoxy)propanoic acid |
| SMILES | O=C(O)C(COc1ccc(O)cc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18O6S/c15-11-1-3-12(4-2-11)20-9-13(14(16)17)10-5-7-21(18,19)8-6-10/h1-4,10,13,15H,5-9H2,(H,16,17) |
| InChIKey | LHLBKFAKBKLEFV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |