C11H14O4S — CID 84703325
3-[2-(1,1-dioxothietan-3-yl)ethoxy]phenol (PubChem CID 84703325) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-[2-(1,1-dioxothietan-3-yl)ethoxy]phenol.
| Compound Name | 3-[2-(1,1-dioxothietan-3-yl)ethoxy]phenol |
|---|---|
| PubChem CID | 84703325 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-[2-(1,1-dioxothietan-3-yl)ethoxy]phenol |
| SMILES | O=S1(=O)CC(CCOc2cccc(O)c2)C1 |
| InChI | InChI=1S/C11H14O4S/c12-10-2-1-3-11(6-10)15-5-4-9-7-16(13,14)8-9/h1-3,6,9,12H,4-5,7-8H2 |
| InChIKey | WLINKZLAAFMIEX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |