C9H21NO2S — CID 117241821
4,4-dimethyl-2-(methylsulfonylmethyl)pentan-1-amine (PubChem CID 117241821) has the molecular formula C9H21NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is 4,4-dimethyl-2-(methylsulfonylmethyl)pentan-1-amine.
| Compound Name | 4,4-dimethyl-2-(methylsulfonylmethyl)pentan-1-amine |
|---|---|
| PubChem CID | 117241821 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4,4-dimethyl-2-(methylsulfonylmethyl)pentan-1-amine |
| SMILES | CC(C)(C)CC(CN)CS(C)(=O)=O |
| InChI | InChI=1S/C9H21NO2S/c1-9(2,3)5-8(6-10)7-13(4,11)12/h8H,5-7,10H2,1-4H3 |
| InChIKey | QKVLALZBCJRMEE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |